C18H21ClN2O5S — CID 49021544
4-chloro-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-(methanesulfonamido)benzamide (PubChem CID 49021544) has the molecular formula C18H21ClN2O5S and a molecular weight of 412.90 g/mol. Its IUPAC name is 4-chloro-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-(methanesulfonamido)benzamide.
| Compound Name | 4-chloro-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 49021544 |
| Molecular Formula | C18H21ClN2O5S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-chloro-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-(methanesulfonamido)benzamide |
| SMILES | CCOc1ccc(CNC(=O)c2ccc(Cl)c(NS(C)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C18H21ClN2O5S/c1-4-26-16-8-5-12(9-17(16)25-2)11-20-18(22)13-6-7-14(19)15(10-13)21-27(3,23)24/h5-10,21H,4,11H2,1-3H3,(H,20,22) |
| InChIKey | XWCYYVJXBSMHPC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |