C20H26N2O5S — CID 48599378
N-[3-(3,4-dimethoxyphenyl)propyl]-3-(methanesulfonamido)-4-methylbenzamide (PubChem CID 48599378) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-3-(methanesulfonamido)-4-methylbenzamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-3-(methanesulfonamido)-4-methylbenzamide |
|---|---|
| PubChem CID | 48599378 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-3-(methanesulfonamido)-4-methylbenzamide |
| SMILES | COc1ccc(CCCNC(=O)c2ccc(C)c(NS(C)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C20H26N2O5S/c1-14-7-9-16(13-17(14)22-28(4,24)25)20(23)21-11-5-6-15-8-10-18(26-2)19(12-15)27-3/h7-10,12-13,22H,5-6,11H2,1-4H3,(H,21,23) |
| InChIKey | ZLHDLUDZBAKPOH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|