C16H14ClN3O6S — CID 49014753
N-[5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-chlorophenyl]methanesulfonamide (PubChem CID 49014753) has the molecular formula C16H14ClN3O6S and a molecular weight of 411.82 g/mol. Its IUPAC name is N-[5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-chlorophenyl]methanesulfonamide.
| Compound Name | N-[5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-chlorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 49014753 |
| Molecular Formula | C16H14ClN3O6S |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-[5-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]-2-chlorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)NNC(=O)c2ccc3c(c2)OCO3)ccc1Cl |
| InChI | InChI=1S/C16H14ClN3O6S/c1-27(23,24)20-12-6-9(2-4-11(12)17)15(21)18-19-16(22)10-3-5-13-14(7-10)26-8-25-13/h2-7,20H,8H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | RFSXKVZNOUNFBM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|