C15H9ClF2N2O4 — CID 8890859
N'-(2-chloro-4,5-difluorobenzoyl)-1,3-benzodioxole-5-carbohydrazide (PubChem CID 8890859) has the molecular formula C15H9ClF2N2O4 and a molecular weight of 354.70 g/mol. Its IUPAC name is N'-(2-chloro-4,5-difluorobenzoyl)-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-(2-chloro-4,5-difluorobenzoyl)-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 8890859 |
| Molecular Formula | C15H9ClF2N2O4 |
| Molecular Weight | 354.70 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | N'-(2-chloro-4,5-difluorobenzoyl)-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(F)c(F)cc1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H9ClF2N2O4/c16-9-5-11(18)10(17)4-8(9)15(22)20-19-14(21)7-1-2-12-13(3-7)24-6-23-12/h1-5H,6H2,(H,19,21)(H,20,22) |
| InChIKey | YLLSIBNAXQYVBM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|