C14H10Cl2N2O5S — CID 8523762
N'-(2,3-dichlorophenyl)sulfonyl-1,3-benzodioxole-5-carbohydrazide (PubChem CID 8523762) has the molecular formula C14H10Cl2N2O5S and a molecular weight of 389.22 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)sulfonyl-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-(2,3-dichlorophenyl)sulfonyl-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 8523762 |
| Molecular Formula | C14H10Cl2N2O5S |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | N'-(2,3-dichlorophenyl)sulfonyl-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cccc(Cl)c1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H10Cl2N2O5S/c15-9-2-1-3-12(13(9)16)24(20,21)18-17-14(19)8-4-5-10-11(6-8)23-7-22-10/h1-6,18H,7H2,(H,17,19) |
| InChIKey | TUKIIAQANKQYSC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|