C16H10Cl2O4 — CID 83955485
(Z)-2-(1,3-benzodioxol-5-yl)-3-(2,6-dichlorophenyl)prop-2-enoic acid (PubChem CID 83955485) has the molecular formula C16H10Cl2O4 and a molecular weight of 337.16 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-3-(2,6-dichlorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(2,6-dichlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83955485 |
| Molecular Formula | C16H10Cl2O4 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(2,6-dichlorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1c(Cl)cccc1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H10Cl2O4/c17-12-2-1-3-13(18)11(12)7-10(16(19)20)9-4-5-14-15(6-9)22-8-21-14/h1-7H,8H2,(H,19,20)/b10-7- |
| InChIKey | XZFNNOYFUYVLJF-YFHOEESVSA-N |
| XLogP | 4.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|