2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate

C16H12Cl2O5 — CID 8012704

IUPAC2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate
SMILESO=C(OCCOc1c(Cl)cccc1Cl)c1ccc2c(c1)OCO2
InChIInChI=1S/C16H12Cl2O5/c17-11-2-1-3-12(18)15(11)20-6-7-21-16(19)10-4-5-13-14(8-10)23-9-22-13/h1-5,8H,6-7,9H2
InChIKeyJXNJZLVFQZCABP-UHFFFAOYSA-N
MW355.17 g/mol
LogP3.96
Rot. Bonds5

About 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate

2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate (PubChem CID 8012704) has the molecular formula C16H12Cl2O5 and a molecular weight of 355.17 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate
PubChem CID8012704
Molecular FormulaC16H12Cl2O5
Molecular Weight355.17 g/mol
Exact Mass354.01
IUPAC Name2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate
SMILESO=C(OCCOc1c(Cl)cccc1Cl)c1ccc2c(c1)OCO2
InChIInChI=1S/C16H12Cl2O5/c17-11-2-1-3-12(18)15(11)20-6-7-21-16(19)10-4-5-13-14(8-10)23-9-22-13/h1-5,8H,6-7,9H2
InChIKeyJXNJZLVFQZCABP-UHFFFAOYSA-N
XLogP3.96
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.17
LogP ≤ 53.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate?
The IUPAC name of 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate (CID 8012704) is 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate is O=C(OCCOc1c(Cl)cccc1Cl)c1ccc2c(c1)OCO2.
What is the InChIKey of 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate?
The InChIKey is JXNJZLVFQZCABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2O5/c17-11-2-1-3-12(18)15(11)20-6-7-21-16(19)10-4-5-13-14(8-10)23-9-22-13/h1-5,8H,6-7,9H2.
What are the key properties of 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate?
2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate has a molecular weight of 355.17 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenoxy)ethyl 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 8012704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).