1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate

C16H13ClO4 — CID 18081790

IUPAC1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate
SMILESCC(OC(=O)c1ccc2c(c1)OCO2)c1ccccc1Cl
InChIInChI=1S/C16H13ClO4/c1-10(12-4-2-3-5-13(12)17)21-16(18)11-6-7-14-15(8-11)20-9-19-14/h2-8,10H,9H2,1H3
InChIKeyRPJFFKGHWVXLHG-UHFFFAOYSA-N
MW304.73 g/mol
LogP3.99
Rot. Bonds3

About 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate

1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate (PubChem CID 18081790) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate
PubChem CID18081790
Molecular FormulaC16H13ClO4
Molecular Weight304.73 g/mol
Exact Mass304.05
IUPAC Name1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate
SMILESCC(OC(=O)c1ccc2c(c1)OCO2)c1ccccc1Cl
InChIInChI=1S/C16H13ClO4/c1-10(12-4-2-3-5-13(12)17)21-16(18)11-6-7-14-15(8-11)20-9-19-14/h2-8,10H,9H2,1H3
InChIKeyRPJFFKGHWVXLHG-UHFFFAOYSA-N
XLogP3.99
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.73
LogP ≤ 53.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate?
The IUPAC name of 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate (CID 18081790) is 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate is CC(OC(=O)c1ccc2c(c1)OCO2)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate?
The InChIKey is RPJFFKGHWVXLHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO4/c1-10(12-4-2-3-5-13(12)17)21-16(18)11-6-7-14-15(8-11)20-9-19-14/h2-8,10H,9H2,1H3.
What are the key properties of 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate?
1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate has a molecular weight of 304.73 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 18081790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).