C16H13ClO4 — CID 18081790
1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate (PubChem CID 18081790) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18081790 |
| Molecular Formula | C16H13ClO4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl 1,3-benzodioxole-5-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1)OCO2)c1ccccc1Cl |
| InChI | InChI=1S/C16H13ClO4/c1-10(12-4-2-3-5-13(12)17)21-16(18)11-6-7-14-15(8-11)20-9-19-14/h2-8,10H,9H2,1H3 |
| InChIKey | RPJFFKGHWVXLHG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |