About 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate
1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate (PubChem CID 18192610) has the molecular formula C16H15ClO3S
and a molecular weight of 322.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate |
| PubChem CID | 18192610 |
| Molecular Formula | C16H15ClO3S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate |
| SMILES | CC(OC(=O)c1ccc(S(C)=O)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClO3S/c1-11(14-5-3-4-6-15(14)17)20-16(18)12-7-9-13(10-8-12)21(2)19/h3-11H,1-2H3 |
| InChIKey | ZPPSPVRPJACPEZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate?
The IUPAC name of 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate (CID 18192610) is 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate.
What is the SMILES notation for 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate?
The canonical SMILES for 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate is CC(OC(=O)c1ccc(S(C)=O)cc1)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate?
The InChIKey is ZPPSPVRPJACPEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO3S/c1-11(14-5-3-4-6-15(14)17)20-16(18)12-7-9-13(10-8-12)21(2)19/h3-11H,1-2H3.
What are the key properties of 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate?
1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate has a molecular weight of 322.81 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)ethyl 4-methylsulfinylbenzoate is sourced from PubChem (CID 18192610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).