C15H13Cl2NO4S — CID 18083132
1-(2-chlorophenyl)ethyl 4-chloro-3-sulfamoylbenzoate (PubChem CID 18083132) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 4-chloro-3-sulfamoylbenzoate.
| Compound Name | 1-(2-chlorophenyl)ethyl 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 18083132 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl 4-chloro-3-sulfamoylbenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)c1ccccc1Cl |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-9(11-4-2-3-5-12(11)16)22-15(19)10-6-7-13(17)14(8-10)23(18,20)21/h2-9H,1H3,(H2,18,20,21) |
| InChIKey | VCPIGAQSZXATTM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |