C17H14ClN3O5S — CID 135739558
[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 135739558) has the molecular formula C17H14ClN3O5S and a molecular weight of 407.84 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 135739558 |
| Molecular Formula | C17H14ClN3O5S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H14ClN3O5S/c1-9(15-20-13-5-3-2-4-11(13)16(22)21-15)26-17(23)10-6-7-12(18)14(8-10)27(19,24)25/h2-9H,1H3,(H2,19,24,25)(H,20,21,22)/t9-/m1/s1 |
| InChIKey | FIHVCBCHFREJMT-SECBINFHSA-N |
| XLogP | 2.14 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |