C17H12ClN3O5 — CID 135583365
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-nitrobenzoate (PubChem CID 135583365) has the molecular formula C17H12ClN3O5 and a molecular weight of 373.75 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 135583365 |
| Molecular Formula | C17H12ClN3O5 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-chloro-3-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H12ClN3O5/c1-9(15-19-13-5-3-2-4-11(13)16(22)20-15)26-17(23)10-6-7-12(18)14(8-10)21(24)25/h2-9H,1H3,(H,19,20,22)/t9-/m0/s1 |
| InChIKey | VCLUABPWOXZOJD-VIFPVBQESA-N |
| XLogP | 3.40 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|