C21H23N3O5S — CID 135991717
1-(4-oxo-3H-quinazolin-2-yl)ethyl 3-(diethylsulfamoyl)benzoate (PubChem CID 135991717) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 1-(4-oxo-3H-quinazolin-2-yl)ethyl 3-(diethylsulfamoyl)benzoate.
| Compound Name | 1-(4-oxo-3H-quinazolin-2-yl)ethyl 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 135991717 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-(4-oxo-3H-quinazolin-2-yl)ethyl 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OC(C)c2nc3ccccc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C21H23N3O5S/c1-4-24(5-2)30(27,28)16-10-8-9-15(13-16)21(26)29-14(3)19-22-18-12-7-6-11-17(18)20(25)23-19/h6-14H,4-5H2,1-3H3,(H,22,23,25) |
| InChIKey | QZMVFVVWVJQKQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |