C10H11ClN2O7S — CID 25133412
1-nitrooxypropan-2-yl 4-chloro-3-sulfamoylbenzoate (PubChem CID 25133412) has the molecular formula C10H11ClN2O7S and a molecular weight of 338.73 g/mol. Its IUPAC name is 1-nitrooxypropan-2-yl 4-chloro-3-sulfamoylbenzoate.
| Compound Name | 1-nitrooxypropan-2-yl 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 25133412 |
| Molecular Formula | C10H11ClN2O7S |
| Molecular Weight | 338.73 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 1-nitrooxypropan-2-yl 4-chloro-3-sulfamoylbenzoate |
| SMILES | CC(CO[N+](=O)[O-])OC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H11ClN2O7S/c1-6(5-19-13(15)16)20-10(14)7-2-3-8(11)9(4-7)21(12,17)18/h2-4,6H,5H2,1H3,(H2,12,17,18) |
| InChIKey | VAJKFBPTMKHYQZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.73 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|