4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate

C13H16Cl2O4S — CID 65397533

IUPAC4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate
SMILESCC(C)CC(C)OC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
InChIInChI=1S/C13H16Cl2O4S/c1-8(2)6-9(3)19-13(16)10-4-5-11(14)12(7-10)20(15,17)18/h4-5,7-9H,6H2,1-3H3
InChIKeyIOMOFSWLHUAZHG-UHFFFAOYSA-N
MW339.24 g/mol
LogP3.86
Rot. Bonds5

About 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate

4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate (PubChem CID 65397533) has the molecular formula C13H16Cl2O4S and a molecular weight of 339.24 g/mol. Its IUPAC name is 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate.

Molecular Properties

Compound Name4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate
PubChem CID65397533
Molecular FormulaC13H16Cl2O4S
Molecular Weight339.24 g/mol
Exact Mass338.01
IUPAC Name4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate
SMILESCC(C)CC(C)OC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
InChIInChI=1S/C13H16Cl2O4S/c1-8(2)6-9(3)19-13(16)10-4-5-11(14)12(7-10)20(15,17)18/h4-5,7-9H,6H2,1-3H3
InChIKeyIOMOFSWLHUAZHG-UHFFFAOYSA-N
XLogP3.86
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.24
LogP ≤ 53.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate?
The IUPAC name of 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate (CID 65397533) is 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate.
What is the SMILES notation for 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate?
The canonical SMILES for 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate is CC(C)CC(C)OC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1.
What is the InChIKey of 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate?
The InChIKey is IOMOFSWLHUAZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2O4S/c1-8(2)6-9(3)19-13(16)10-4-5-11(14)12(7-10)20(15,17)18/h4-5,7-9H,6H2,1-3H3.
What are the key properties of 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate?
4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate has a molecular weight of 339.24 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl 4-chloro-3-chlorosulfonylbenzoate is sourced from PubChem (CID 65397533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).