About 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate
4-methylpentan-2-yl 3-chloro-4-nitrobenzoate (PubChem CID 82787588) has the molecular formula C13H16ClNO4
and a molecular weight of 285.73 g/mol. Its IUPAC name is 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate |
| PubChem CID | 82787588 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate |
| SMILES | CC(C)CC(C)OC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO4/c1-8(2)6-9(3)19-13(16)10-4-5-12(15(17)18)11(14)7-10/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | QYVBOYCSJSMLCV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate?
The IUPAC name of 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate (CID 82787588) is 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate.
What is the SMILES notation for 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate?
The canonical SMILES for 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate is CC(C)CC(C)OC(=O)c1ccc([N+](=O)[O-])c(Cl)c1.
What is the InChIKey of 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate?
The InChIKey is QYVBOYCSJSMLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO4/c1-8(2)6-9(3)19-13(16)10-4-5-12(15(17)18)11(14)7-10/h4-5,7-9H,6H2,1-3H3.
What are the key properties of 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate?
4-methylpentan-2-yl 3-chloro-4-nitrobenzoate has a molecular weight of 285.73 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl 3-chloro-4-nitrobenzoate is sourced from PubChem (CID 82787588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).