C13H12ClNO4S2 — CID 18102722
1-(2-chlorophenyl)ethyl 5-sulfamoylthiophene-3-carboxylate (PubChem CID 18102722) has the molecular formula C13H12ClNO4S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | 1-(2-chlorophenyl)ethyl 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18102722 |
| Molecular Formula | C13H12ClNO4S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl 5-sulfamoylthiophene-3-carboxylate |
| SMILES | CC(OC(=O)c1csc(S(N)(=O)=O)c1)c1ccccc1Cl |
| InChI | InChI=1S/C13H12ClNO4S2/c1-8(10-4-2-3-5-11(10)14)19-13(16)9-6-12(20-7-9)21(15,17)18/h2-8H,1H3,(H2,15,17,18) |
| InChIKey | NYJKPYPROFKZDA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |