About 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate
1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate (PubChem CID 18083137) has the molecular formula C16H15ClO4S
and a molecular weight of 338.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate |
| PubChem CID | 18083137 |
| Molecular Formula | C16H15ClO4S |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccccc1S(C)(=O)=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClO4S/c1-11(12-7-3-5-9-14(12)17)21-16(18)13-8-4-6-10-15(13)22(2,19)20/h3-11H,1-2H3 |
| InChIKey | UOUXKAURECULIZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate?
The IUPAC name of 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate (CID 18083137) is 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate.
What is the SMILES notation for 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate?
The canonical SMILES for 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate is CC(OC(=O)c1ccccc1S(C)(=O)=O)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate?
The InChIKey is UOUXKAURECULIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO4S/c1-11(12-7-3-5-9-14(12)17)21-16(18)13-8-4-6-10-15(13)22(2,19)20/h3-11H,1-2H3.
What are the key properties of 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate?
1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate has a molecular weight of 338.81 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)ethyl 2-methylsulfonylbenzoate is sourced from PubChem (CID 18083137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).