C15H12Cl3NO4S — CID 8762036
[(1S)-1-(2-chlorophenyl)ethyl] 2,4-dichloro-5-sulfamoylbenzoate (PubChem CID 8762036) has the molecular formula C15H12Cl3NO4S and a molecular weight of 408.69 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl] 2,4-dichloro-5-sulfamoylbenzoate.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl] 2,4-dichloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8762036 |
| Molecular Formula | C15H12Cl3NO4S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl] 2,4-dichloro-5-sulfamoylbenzoate |
| SMILES | C[C@H](OC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C15H12Cl3NO4S/c1-8(9-4-2-3-5-11(9)16)23-15(20)10-6-14(24(19,21)22)13(18)7-12(10)17/h2-8H,1H3,(H2,19,21,22)/t8-/m0/s1 |
| InChIKey | SHJUVHPJLUOZKL-QMMMGPOBSA-N |
| XLogP | 4.21 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |