C19H20ClNO3S — CID 9066796
[(1S)-1-(2-chlorophenyl)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 9066796) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 9066796 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1SCC(=O)N(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClNO3S/c1-13(14-8-4-6-10-16(14)20)24-19(23)15-9-5-7-11-17(15)25-12-18(22)21(2)3/h4-11,13H,12H2,1-3H3/t13-/m0/s1 |
| InChIKey | NVYSWSNWUADPNY-ZDUSSCGKSA-N |
| XLogP | 4.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |