C21H25NO5S — CID 9066734
2-(4-ethoxyphenoxy)ethyl 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 9066734) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 9066734 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | CCOc1ccc(OCCOC(=O)c2ccccc2SCC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-4-25-16-9-11-17(12-10-16)26-13-14-27-21(24)18-7-5-6-8-19(18)28-15-20(23)22(2)3/h5-12H,4,13-15H2,1-3H3 |
| InChIKey | FIKWCMMRRRHESP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|