C22H26N2O4S — CID 9066604
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 9066604) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 9066604 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | CC(C)N(C(=O)COC(=O)c1ccccc1SCC(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-16(2)24(17-10-6-5-7-11-17)20(25)14-28-22(27)18-12-8-9-13-19(18)29-15-21(26)23(3)4/h5-13,16H,14-15H2,1-4H3 |
| InChIKey | GUSGOBZXIBLWLK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |