C20H20ClN3O5S — CID 17496466
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 17496466) has the molecular formula C20H20ClN3O5S and a molecular weight of 449.92 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 17496466 |
| Molecular Formula | C20H20ClN3O5S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | CN(C)C(=O)CSc1ccccc1C(=O)OCC(=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O5S/c1-24(2)18(26)12-30-16-6-4-3-5-15(16)20(28)29-11-17(25)22-23-19(27)13-7-9-14(21)10-8-13/h3-10H,11-12H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | WHZTZZCFALZKHG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|