C21H25N3O4S — CID 9324278
2-[2-[[[2-(4-ethylphenoxy)acetyl]amino]carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide (PubChem CID 9324278) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[2-[[[2-(4-ethylphenoxy)acetyl]amino]carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide.
| Compound Name | 2-[2-[[[2-(4-ethylphenoxy)acetyl]amino]carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 9324278 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-[2-[[[2-(4-ethylphenoxy)acetyl]amino]carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)c2ccccc2SCC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-4-15-9-11-16(12-10-15)28-13-19(25)22-23-21(27)17-7-5-6-8-18(17)29-14-20(26)24(2)3/h5-12H,4,13-14H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | BRWSOWVRSRLOGC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|