C17H15ClN2O5 — CID 2640368
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxybenzoate (PubChem CID 2640368) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxybenzoate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 2640368 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC(=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O5/c1-24-14-5-3-2-4-13(14)17(23)25-10-15(21)19-20-16(22)11-6-8-12(18)9-7-11/h2-9H,10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | BUIBFDJSOUGNGU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|