C18H16N2O5S2 — CID 27936534
[(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 27936534) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 27936534 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1csc(S(N)(=O)=O)c1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H16N2O5S2/c1-11(25-18(22)14-9-16(26-10-14)27(19,23)24)17(21)20-15-7-6-12-4-2-3-5-13(12)8-15/h2-11H,1H3,(H,20,21)(H2,19,23,24)/t11-/m1/s1 |
| InChIKey | UWCRVBGNQJESGA-LLVKDONJSA-N |
| XLogP | 2.73 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |