C15H15ClN2O6S2 — CID 46648512
[1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 46648512) has the molecular formula C15H15ClN2O6S2 and a molecular weight of 418.88 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 46648512 |
| Molecular Formula | C15H15ClN2O6S2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | [1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(C)OC(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H15ClN2O6S2/c1-8(14(19)18-11-6-10(16)3-4-12(11)23-2)24-15(20)9-5-13(25-7-9)26(17,21)22/h3-8H,1-2H3,(H,18,19)(H2,17,21,22) |
| InChIKey | SWCUGXMNNUFRJH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |