C12H18N2O5S2 — CID 18102735
[1-(tert-butylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 18102735) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [1-(tert-butylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18102735 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | CC(OC(=O)c1csc(S(N)(=O)=O)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H18N2O5S2/c1-7(10(15)14-12(2,3)4)19-11(16)8-5-9(20-6-8)21(13,17)18/h5-7H,1-4H3,(H,14,15)(H2,13,17,18) |
| InChIKey | LOGJBRANUMAXTJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |