C15H15N3O6S2 — CID 55462894
[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 55462894) has the molecular formula C15H15N3O6S2 and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55462894 |
| Molecular Formula | C15H15N3O6S2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | CNC(=O)NC(=O)C(OC(=O)c1csc(S(N)(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O6S2/c1-17-15(21)18-13(19)12(9-5-3-2-4-6-9)24-14(20)10-7-11(25-8-10)26(16,22)23/h2-8,12H,1H3,(H2,16,22,23)(H2,17,18,19,21) |
| InChIKey | MUXUJVDNJHMRLR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |