C21H18N2O4 — CID 2674820
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] naphthalene-2-carboxylate (PubChem CID 2674820) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] naphthalene-2-carboxylate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2674820 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] naphthalene-2-carboxylate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O4/c1-22-21(26)23-19(24)18(15-8-3-2-4-9-15)27-20(25)17-12-11-14-7-5-6-10-16(14)13-17/h2-13,18H,1H3,(H2,22,23,24,26)/t18-/m1/s1 |
| InChIKey | IPKSZIBFROTAJY-GOSISDBHSA-N |
| XLogP | 3.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |