C22H20N2O4S — CID 7795814
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 7795814) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 7795814 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)CSc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4S/c1-23-22(27)24-21(26)20(16-8-3-2-4-9-16)28-19(25)14-29-18-12-11-15-7-5-6-10-17(15)13-18/h2-13,20H,14H2,1H3,(H2,23,24,26,27)/t20-/m1/s1 |
| InChIKey | PSPINBRGWDVHHI-HXUWFJFHSA-N |
| XLogP | 3.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |