C24H25NO3S — CID 9205201
[(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 9205201) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is [(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 9205201 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | CCN(CC)C(=O)[C@H](OC(=O)CSc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO3S/c1-3-25(4-2)24(27)23(19-11-6-5-7-12-19)28-22(26)17-29-21-15-14-18-10-8-9-13-20(18)16-21/h5-16,23H,3-4,17H2,1-2H3/t23-/m1/s1 |
| InChIKey | WHRJQROCHCDYDE-HSZRJFAPSA-N |
| XLogP | 5.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |