C25H25NO3S — CID 7700584
[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 7700584) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 7700584 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | O=C(CSc1ccc2ccccc2c1)O[C@H](C(=O)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO3S/c27-23(18-30-22-14-13-19-9-5-6-12-21(19)17-22)29-24(20-10-3-1-4-11-20)25(28)26-15-7-2-8-16-26/h1,3-6,9-14,17,24H,2,7-8,15-16,18H2/t24-/m0/s1 |
| InChIKey | YPGGUKUWBCHWGJ-DEOSSOPVSA-N |
| XLogP | 5.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |