C13H16N2O5 — CID 7776199
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methoxyacetate (PubChem CID 7776199) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methoxyacetate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 7776199 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methoxyacetate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)COC)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O5/c1-14-13(18)15-12(17)11(20-10(16)8-19-2)9-6-4-3-5-7-9/h3-7,11H,8H2,1-2H3,(H2,14,15,17,18)/t11-/m1/s1 |
| InChIKey | VQLYSYXUPUSKCQ-LLVKDONJSA-N |
| XLogP | 0.37 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |