C11H17NO4S2 — CID 65382673
4-methylpentan-2-yl 5-sulfamoylthiophene-3-carboxylate (PubChem CID 65382673) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-methylpentan-2-yl 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | 4-methylpentan-2-yl 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 65382673 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-methylpentan-2-yl 5-sulfamoylthiophene-3-carboxylate |
| SMILES | CC(C)CC(C)OC(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17NO4S2/c1-7(2)4-8(3)16-11(13)9-5-10(17-6-9)18(12,14)15/h5-8H,4H2,1-3H3,(H2,12,14,15) |
| InChIKey | FYYJNWXWYNZBQB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |