C11H16N2O5S2 — CID 119361365
(2S)-4-methyl-2-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid (PubChem CID 119361365) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119361365 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (2S)-4-methyl-2-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1csc(S(N)(=O)=O)c1)C(=O)O |
| InChI | InChI=1S/C11H16N2O5S2/c1-6(2)3-8(11(15)16)13-10(14)7-4-9(19-5-7)20(12,17)18/h4-6,8H,3H2,1-2H3,(H,13,14)(H,15,16)(H2,12,17,18)/t8-/m0/s1 |
| InChIKey | ACCMCZMTYVZXDH-QMMMGPOBSA-N |
| XLogP | 0.62 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |