C16H21N3O3S2 — CID 119525543
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-5-sulfamoylthiophene-3-carboxamide (PubChem CID 119525543) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-5-sulfamoylthiophene-3-carboxamide.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-5-sulfamoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 119525543 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-5-sulfamoylthiophene-3-carboxamide |
| SMILES | CC(C)c1ccc(C(N)CNC(=O)c2csc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-10(2)11-3-5-12(6-4-11)14(17)8-19-16(20)13-7-15(23-9-13)24(18,21)22/h3-7,9-10,14H,8,17H2,1-2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | OGCBWDDJBSFWAD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |