C13H14N2O3S2 — CID 36650596
N-[(4-methylphenyl)methyl]-5-sulfamoylthiophene-3-carboxamide (PubChem CID 36650596) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-5-sulfamoylthiophene-3-carboxamide.
| Compound Name | N-[(4-methylphenyl)methyl]-5-sulfamoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 36650596 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-5-sulfamoylthiophene-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2csc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-9-2-4-10(5-3-9)7-15-13(16)11-6-12(19-8-11)20(14,17)18/h2-6,8H,7H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | ZLTVDVAJHHODSC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |