C8H12N2O4S3 — CID 115631261
N-(2-methylsulfinylethyl)-5-sulfamoylthiophene-3-carboxamide (PubChem CID 115631261) has the molecular formula C8H12N2O4S3 and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(2-methylsulfinylethyl)-5-sulfamoylthiophene-3-carboxamide.
| Compound Name | N-(2-methylsulfinylethyl)-5-sulfamoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 115631261 |
| Molecular Formula | C8H12N2O4S3 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | N-(2-methylsulfinylethyl)-5-sulfamoylthiophene-3-carboxamide |
| SMILES | CS(=O)CCNC(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H12N2O4S3/c1-16(12)3-2-10-8(11)6-4-7(15-5-6)17(9,13)14/h4-5H,2-3H2,1H3,(H,10,11)(H2,9,13,14) |
| InChIKey | KLFNUFCQPWJAKV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |