C10H14N2O5S2 — CID 119235236
5-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid (PubChem CID 119235236) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119235236 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 5-[(5-sulfamoylthiophene-3-carbonyl)amino]pentanoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCCCCC(=O)O)cs1 |
| InChI | InChI=1S/C10H14N2O5S2/c11-19(16,17)9-5-7(6-18-9)10(15)12-4-2-1-3-8(13)14/h5-6H,1-4H2,(H,12,15)(H,13,14)(H2,11,16,17) |
| InChIKey | RTRAJAPFLANALX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|