C10H13F3N2O3S2 — CID 115491568
5-sulfamoyl-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide (PubChem CID 115491568) has the molecular formula C10H13F3N2O3S2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 5-sulfamoyl-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide.
| Compound Name | 5-sulfamoyl-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 115491568 |
| Molecular Formula | C10H13F3N2O3S2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 5-sulfamoyl-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCCCCC(F)(F)F)cs1 |
| InChI | InChI=1S/C10H13F3N2O3S2/c11-10(12,13)3-1-2-4-15-9(16)7-5-8(19-6-7)20(14,17)18/h5-6H,1-4H2,(H,15,16)(H2,14,17,18) |
| InChIKey | VKULILVVYWCWAG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|