C11H15F3N2O4S — CID 115491569
5-methyl-4-sulfamoyl-N-(5,5,5-trifluoropentyl)furan-2-carboxamide (PubChem CID 115491569) has the molecular formula C11H15F3N2O4S and a molecular weight of 328.31 g/mol. Its IUPAC name is 5-methyl-4-sulfamoyl-N-(5,5,5-trifluoropentyl)furan-2-carboxamide.
| Compound Name | 5-methyl-4-sulfamoyl-N-(5,5,5-trifluoropentyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 115491569 |
| Molecular Formula | C11H15F3N2O4S |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-methyl-4-sulfamoyl-N-(5,5,5-trifluoropentyl)furan-2-carboxamide |
| SMILES | Cc1oc(C(=O)NCCCCC(F)(F)F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H15F3N2O4S/c1-7-9(21(15,18)19)6-8(20-7)10(17)16-5-3-2-4-11(12,13)14/h6H,2-5H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | GWGCHKJEQBRNHG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|