C10H16N2O5S2 — CID 115688805
5-methyl-N-(3-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 115688805) has the molecular formula C10H16N2O5S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 5-methyl-N-(3-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-methyl-N-(3-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 115688805 |
| Molecular Formula | C10H16N2O5S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 5-methyl-N-(3-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | Cc1oc(C(=O)NCCCS(C)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H16N2O5S2/c1-7-9(19(11,15)16)6-8(17-7)10(13)12-4-3-5-18(2)14/h6H,3-5H2,1-2H3,(H,12,13)(H2,11,15,16) |
| InChIKey | RTAUUKIMXHYBQK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|