C9H12ClNO5S — CID 65368796
5-(2-methoxyethylcarbamoyl)-2-methylfuran-3-sulfonyl chloride (PubChem CID 65368796) has the molecular formula C9H12ClNO5S and a molecular weight of 281.72 g/mol. Its IUPAC name is 5-(2-methoxyethylcarbamoyl)-2-methylfuran-3-sulfonyl chloride.
| Compound Name | 5-(2-methoxyethylcarbamoyl)-2-methylfuran-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65368796 |
| Molecular Formula | C9H12ClNO5S |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 5-(2-methoxyethylcarbamoyl)-2-methylfuran-3-sulfonyl chloride |
| SMILES | COCCNC(=O)c1cc(S(=O)(=O)Cl)c(C)o1 |
| InChI | InChI=1S/C9H12ClNO5S/c1-6-8(17(10,13)14)5-7(16-6)9(12)11-3-4-15-2/h5H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | BXDOWHMCXSFZIL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|