C12H17BrClNO5S — CID 65395844
2-bromo-5-[2-(3-methylbutoxy)ethylcarbamoyl]furan-3-sulfonyl chloride (PubChem CID 65395844) has the molecular formula C12H17BrClNO5S and a molecular weight of 402.69 g/mol. Its IUPAC name is 2-bromo-5-[2-(3-methylbutoxy)ethylcarbamoyl]furan-3-sulfonyl chloride.
| Compound Name | 2-bromo-5-[2-(3-methylbutoxy)ethylcarbamoyl]furan-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65395844 |
| Molecular Formula | C12H17BrClNO5S |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 2-bromo-5-[2-(3-methylbutoxy)ethylcarbamoyl]furan-3-sulfonyl chloride |
| SMILES | CC(C)CCOCCNC(=O)c1cc(S(=O)(=O)Cl)c(Br)o1 |
| InChI | InChI=1S/C12H17BrClNO5S/c1-8(2)3-5-19-6-4-15-12(16)9-7-10(11(13)20-9)21(14,17)18/h7-8H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | GJNYIUBUBUAVPN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|