C13H22N2O5S — CID 65387670
5-methyl-N-[2-(3-methylbutoxy)ethyl]-4-sulfamoylfuran-2-carboxamide (PubChem CID 65387670) has the molecular formula C13H22N2O5S and a molecular weight of 318.39 g/mol. Its IUPAC name is 5-methyl-N-[2-(3-methylbutoxy)ethyl]-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-methyl-N-[2-(3-methylbutoxy)ethyl]-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 65387670 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-methyl-N-[2-(3-methylbutoxy)ethyl]-4-sulfamoylfuran-2-carboxamide |
| SMILES | Cc1oc(C(=O)NCCOCCC(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H22N2O5S/c1-9(2)4-6-19-7-5-15-13(16)11-8-12(10(3)20-11)21(14,17)18/h8-9H,4-7H2,1-3H3,(H,15,16)(H2,14,17,18) |
| InChIKey | QQLBCLCSMOPZIK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|