C12H22ClN3O4S — CID 119588835
N-(1-amino-4-methylpentan-2-yl)-5-methyl-4-sulfamoylfuran-2-carboxamide;hydrochloride (PubChem CID 119588835) has the molecular formula C12H22ClN3O4S and a molecular weight of 339.85 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-5-methyl-4-sulfamoylfuran-2-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-5-methyl-4-sulfamoylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119588835 |
| Molecular Formula | C12H22ClN3O4S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-5-methyl-4-sulfamoylfuran-2-carboxamide;hydrochloride |
| SMILES | Cc1oc(C(=O)NC(CN)CC(C)C)cc1S(N)(=O)=O.Cl |
| InChI | InChI=1S/C12H21N3O4S.ClH/c1-7(2)4-9(6-13)15-12(16)10-5-11(8(3)19-10)20(14,17)18;/h5,7,9H,4,6,13H2,1-3H3,(H,15,16)(H2,14,17,18);1H |
| InChIKey | NLMQQBVHWIBHRB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |