C9H8ClF4NO4S — CID 106295734
2-methyl-5-(2,2,3,3-tetrafluoropropylcarbamoyl)furan-3-sulfonyl chloride (PubChem CID 106295734) has the molecular formula C9H8ClF4NO4S and a molecular weight of 337.68 g/mol. Its IUPAC name is 2-methyl-5-(2,2,3,3-tetrafluoropropylcarbamoyl)furan-3-sulfonyl chloride.
| Compound Name | 2-methyl-5-(2,2,3,3-tetrafluoropropylcarbamoyl)furan-3-sulfonyl chloride |
|---|---|
| PubChem CID | 106295734 |
| Molecular Formula | C9H8ClF4NO4S |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 2-methyl-5-(2,2,3,3-tetrafluoropropylcarbamoyl)furan-3-sulfonyl chloride |
| SMILES | Cc1oc(C(=O)NCC(F)(F)C(F)F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H8ClF4NO4S/c1-4-6(20(10,17)18)2-5(19-4)7(16)15-3-9(13,14)8(11)12/h2,8H,3H2,1H3,(H,15,16) |
| InChIKey | ZOSJRENJCFWTJJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|