C10H7ClF5NO3S — CID 106295727
2-fluoro-5-(2,2,3,3-tetrafluoropropylcarbamoyl)benzenesulfonyl chloride (PubChem CID 106295727) has the molecular formula C10H7ClF5NO3S and a molecular weight of 351.68 g/mol. Its IUPAC name is 2-fluoro-5-(2,2,3,3-tetrafluoropropylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2-fluoro-5-(2,2,3,3-tetrafluoropropylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 106295727 |
| Molecular Formula | C10H7ClF5NO3S |
| Molecular Weight | 351.68 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 2-fluoro-5-(2,2,3,3-tetrafluoropropylcarbamoyl)benzenesulfonyl chloride |
| SMILES | O=C(NCC(F)(F)C(F)F)c1ccc(F)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C10H7ClF5NO3S/c11-21(19,20)7-3-5(1-2-6(7)12)8(18)17-4-10(15,16)9(13)14/h1-3,9H,4H2,(H,17,18) |
| InChIKey | AUGHCNYHVZMETL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|