C11H7F8NO — CID 103528324
2-fluoro-N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)benzamide (PubChem CID 103528324) has the molecular formula C11H7F8NO and a molecular weight of 321.17 g/mol. Its IUPAC name is 2-fluoro-N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103528324 |
| Molecular Formula | C11H7F8NO |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-fluoro-N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H7F8NO/c12-7-2-1-5(11(17,18)19)3-6(7)8(21)20-4-10(15,16)9(13)14/h1-3,9H,4H2,(H,20,21) |
| InChIKey | QREMOQNMTBRZIY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|